C15H14N2O5S — CID 126196697
(2R)-2-[2-[(E)-(1-methyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]propanoic acid (PubChem CID 126196697) has the molecular formula C15H14N2O5S and a molecular weight of 334.35 g/mol. Its IUPAC name is (2R)-2-[2-[(E)-(1-methyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]propanoic acid.
| Compound Name | (2R)-2-[2-[(E)-(1-methyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126196697 |
| Molecular Formula | C15H14N2O5S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (2R)-2-[2-[(E)-(1-methyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]propanoic acid |
| SMILES | C[C@@H](Oc1ccccc1/C=C1\C(=O)NC(=S)N(C)C1=O)C(=O)O |
| InChI | InChI=1S/C15H14N2O5S/c1-8(14(20)21)22-11-6-4-3-5-9(11)7-10-12(18)16-15(23)17(2)13(10)19/h3-8H,1-2H3,(H,20,21)(H,16,18,23)/b10-7+/t8-/m1/s1 |
| InChIKey | NYLFPXQALKPYJA-RYGSOJJJSA-N |
| XLogP | 0.80 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|