C22H20N2O6S — CID 126198873
(2R)-2-[2-[(E)-[1-(4-ethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]propanoic acid (PubChem CID 126198873) has the molecular formula C22H20N2O6S and a molecular weight of 440.48 g/mol. Its IUPAC name is (2R)-2-[2-[(E)-[1-(4-ethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]propanoic acid.
| Compound Name | (2R)-2-[2-[(E)-[1-(4-ethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126198873 |
| Molecular Formula | C22H20N2O6S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (2R)-2-[2-[(E)-[1-(4-ethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]propanoic acid |
| SMILES | CCOc1ccc(N2C(=O)/C(=C/c3ccccc3O[C@H](C)C(=O)O)C(=O)NC2=S)cc1 |
| InChI | InChI=1S/C22H20N2O6S/c1-3-29-16-10-8-15(9-11-16)24-20(26)17(19(25)23-22(24)31)12-14-6-4-5-7-18(14)30-13(2)21(27)28/h4-13H,3H2,1-2H3,(H,27,28)(H,23,25,31)/b17-12+/t13-/m1/s1 |
| InChIKey | DFISQPQFYDATRH-LVLBFHFTSA-N |
| XLogP | 2.77 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|