C21H15BrClN3O4 — CID 126198633
N-[(Z)-[3-bromo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-4-chlorobenzamide (PubChem CID 126198633) has the molecular formula C21H15BrClN3O4 and a molecular weight of 488.73 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-4-chlorobenzamide.
| Compound Name | N-[(Z)-[3-bromo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-4-chlorobenzamide |
|---|---|
| PubChem CID | 126198633 |
| Molecular Formula | C21H15BrClN3O4 |
| Molecular Weight | 488.73 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-4-chlorobenzamide |
| SMILES | O=C(N/N=C\c1ccc(OCc2cccc([N+](=O)[O-])c2)c(Br)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H15BrClN3O4/c22-19-11-14(12-24-25-21(27)16-5-7-17(23)8-6-16)4-9-20(19)30-13-15-2-1-3-18(10-15)26(28)29/h1-12H,13H2,(H,25,27)/b24-12- |
| InChIKey | WVMRZAQICULWFD-MSXFZWOLSA-N |
| XLogP | 5.35 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.73 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|