C22H24N2O4S — CID 126203847
2-[4-[[(2S)-butan-2-yl]sulfamoyl]phenoxy]-N-naphthalen-1-ylacetamide (PubChem CID 126203847) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-[4-[[(2S)-butan-2-yl]sulfamoyl]phenoxy]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[4-[[(2S)-butan-2-yl]sulfamoyl]phenoxy]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 126203847 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-[4-[[(2S)-butan-2-yl]sulfamoyl]phenoxy]-N-naphthalen-1-ylacetamide |
| SMILES | CC[C@H](C)NS(=O)(=O)c1ccc(OCC(=O)Nc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-3-16(2)24-29(26,27)19-13-11-18(12-14-19)28-15-22(25)23-21-10-6-8-17-7-4-5-9-20(17)21/h4-14,16,24H,3,15H2,1-2H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | KOVMDIQQRQHNDB-INIZCTEOSA-N |
| XLogP | 3.93 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |