C22H27N3O3S2 — CID 126205641
N-butyl-2-[3-(4-ethoxyphenyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetamide (PubChem CID 126205641) has the molecular formula C22H27N3O3S2 and a molecular weight of 445.61 g/mol. Its IUPAC name is N-butyl-2-[3-(4-ethoxyphenyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-butyl-2-[3-(4-ethoxyphenyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 126205641 |
| Molecular Formula | C22H27N3O3S2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-butyl-2-[3-(4-ethoxyphenyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetamide |
| SMILES | CCCCNC(=O)CSc1nc2sc(C)c(C)c2c(=O)n1-c1ccc(OCC)cc1 |
| InChI | InChI=1S/C22H27N3O3S2/c1-5-7-12-23-18(26)13-29-22-24-20-19(14(3)15(4)30-20)21(27)25(22)16-8-10-17(11-9-16)28-6-2/h8-11H,5-7,12-13H2,1-4H3,(H,23,26) |
| InChIKey | CZPHNJRLZVTSIZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|