C20H22ClN3O3S2 — CID 41167763
2-[3-(4-chlorophenyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide (PubChem CID 41167763) has the molecular formula C20H22ClN3O3S2 and a molecular weight of 452.00 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 41167763 |
| Molecular Formula | C20H22ClN3O3S2 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CSc1nc2sc(C)c(C)c2c(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22ClN3O3S2/c1-12-13(2)29-18-17(12)19(26)24(15-7-5-14(21)6-8-15)20(23-18)28-11-16(25)22-9-4-10-27-3/h5-8H,4,9-11H2,1-3H3,(H,22,25) |
| InChIKey | MUJNCFHCBSHQKX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|