C24H28ClN3O3S — CID 42975295
2-[3-(4-butan-2-ylphenyl)-6-chloro-4-oxoquinazolin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide (PubChem CID 42975295) has the molecular formula C24H28ClN3O3S and a molecular weight of 474.03 g/mol. Its IUPAC name is 2-[3-(4-butan-2-ylphenyl)-6-chloro-4-oxoquinazolin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[3-(4-butan-2-ylphenyl)-6-chloro-4-oxoquinazolin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 42975295 |
| Molecular Formula | C24H28ClN3O3S |
| Molecular Weight | 474.03 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 2-[3-(4-butan-2-ylphenyl)-6-chloro-4-oxoquinazolin-2-yl]sulfanyl-N-(3-methoxypropyl)acetamide |
| SMILES | CCC(C)c1ccc(-n2c(SCC(=O)NCCCOC)nc3ccc(Cl)cc3c2=O)cc1 |
| InChI | InChI=1S/C24H28ClN3O3S/c1-4-16(2)17-6-9-19(10-7-17)28-23(30)20-14-18(25)8-11-21(20)27-24(28)32-15-22(29)26-12-5-13-31-3/h6-11,14,16H,4-5,12-13,15H2,1-3H3,(H,26,29) |
| InChIKey | LCMWLJAUCSSHCL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.03 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|