C20H18ClN3OS — CID 7358934
2-[3-[4-[(2R)-butan-2-yl]phenyl]-6-chloro-4-oxoquinazolin-2-yl]sulfanylacetonitrile (PubChem CID 7358934) has the molecular formula C20H18ClN3OS and a molecular weight of 383.90 g/mol. Its IUPAC name is 2-[3-[4-[(2R)-butan-2-yl]phenyl]-6-chloro-4-oxoquinazolin-2-yl]sulfanylacetonitrile.
| Compound Name | 2-[3-[4-[(2R)-butan-2-yl]phenyl]-6-chloro-4-oxoquinazolin-2-yl]sulfanylacetonitrile |
|---|---|
| PubChem CID | 7358934 |
| Molecular Formula | C20H18ClN3OS |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 2-[3-[4-[(2R)-butan-2-yl]phenyl]-6-chloro-4-oxoquinazolin-2-yl]sulfanylacetonitrile |
| SMILES | CC[C@@H](C)c1ccc(-n2c(SCC#N)nc3ccc(Cl)cc3c2=O)cc1 |
| InChI | InChI=1S/C20H18ClN3OS/c1-3-13(2)14-4-7-16(8-5-14)24-19(25)17-12-15(21)6-9-18(17)23-20(24)26-11-10-22/h4-9,12-13H,3,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | ZDRNZACUXYFFSE-CYBMUJFWSA-N |
| XLogP | 5.17 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |