C22H23ClN4O3S — CID 24587625
3-[3-(4-butan-2-ylphenyl)-7-chloro-4-oxoquinazolin-2-yl]sulfanyl-N-carbamoylpropanamide (PubChem CID 24587625) has the molecular formula C22H23ClN4O3S and a molecular weight of 458.97 g/mol. Its IUPAC name is 3-[3-(4-butan-2-ylphenyl)-7-chloro-4-oxoquinazolin-2-yl]sulfanyl-N-carbamoylpropanamide.
| Compound Name | 3-[3-(4-butan-2-ylphenyl)-7-chloro-4-oxoquinazolin-2-yl]sulfanyl-N-carbamoylpropanamide |
|---|---|
| PubChem CID | 24587625 |
| Molecular Formula | C22H23ClN4O3S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 3-[3-(4-butan-2-ylphenyl)-7-chloro-4-oxoquinazolin-2-yl]sulfanyl-N-carbamoylpropanamide |
| SMILES | CCC(C)c1ccc(-n2c(SCCC(=O)NC(N)=O)nc3cc(Cl)ccc3c2=O)cc1 |
| InChI | InChI=1S/C22H23ClN4O3S/c1-3-13(2)14-4-7-16(8-5-14)27-20(29)17-9-6-15(23)12-18(17)25-22(27)31-11-10-19(28)26-21(24)30/h4-9,12-13H,3,10-11H2,1-2H3,(H3,24,26,28,30) |
| InChIKey | UVPGIWVLAJYRAA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |