C14H20N4O2S2 — CID 39049485
2-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(3-methoxypropyl)acetamide (PubChem CID 39049485) has the molecular formula C14H20N4O2S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 39049485 |
| Molecular Formula | C14H20N4O2S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CSc1nc(N)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C14H20N4O2S2/c1-8-9(2)22-13-11(8)12(15)17-14(18-13)21-7-10(19)16-5-4-6-20-3/h4-7H2,1-3H3,(H,16,19)(H2,15,17,18) |
| InChIKey | SETKBEADGFKCKR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|