C18H21BrN2O3S — CID 126209589
2-[(5Z)-5-[(3-bromophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N,N-di(propan-2-yl)acetamide (PubChem CID 126209589) has the molecular formula C18H21BrN2O3S and a molecular weight of 425.35 g/mol. Its IUPAC name is 2-[(5Z)-5-[(3-bromophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N,N-di(propan-2-yl)acetamide.
| Compound Name | 2-[(5Z)-5-[(3-bromophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N,N-di(propan-2-yl)acetamide |
|---|---|
| PubChem CID | 126209589 |
| Molecular Formula | C18H21BrN2O3S |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 2-[(5Z)-5-[(3-bromophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N,N-di(propan-2-yl)acetamide |
| SMILES | CC(C)N(C(=O)CN1C(=O)S/C(=C\c2cccc(Br)c2)C1=O)C(C)C |
| InChI | InChI=1S/C18H21BrN2O3S/c1-11(2)21(12(3)4)16(22)10-20-17(23)15(25-18(20)24)9-13-6-5-7-14(19)8-13/h5-9,11-12H,10H2,1-4H3/b15-9- |
| InChIKey | VTGHNJFRUIATKK-DHDCSXOGSA-N |
| XLogP | 4.13 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|