C19H11BrN2O4S — CID 157010850
5-[(3-bromophenyl)methylidene]-3-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 157010850) has the molecular formula C19H11BrN2O4S and a molecular weight of 443.28 g/mol. Its IUPAC name is 5-[(3-bromophenyl)methylidene]-3-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(3-bromophenyl)methylidene]-3-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 157010850 |
| Molecular Formula | C19H11BrN2O4S |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 441.96 |
| IUPAC Name | 5-[(3-bromophenyl)methylidene]-3-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2cccc(Br)c2)C(=O)N1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H11BrN2O4S/c20-12-5-3-4-11(8-12)9-15-18(25)22(19(26)27-15)10-21-16(23)13-6-1-2-7-14(13)17(21)24/h1-9H,10H2 |
| InChIKey | UKUKZLQXTVRHJQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|