C29H23Cl2IN2O7S — CID 126211747
2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide (PubChem CID 126211747) has the molecular formula C29H23Cl2IN2O7S and a molecular weight of 741.39 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide.
| Compound Name | 2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
|---|---|
| PubChem CID | 126211747 |
| Molecular Formula | C29H23Cl2IN2O7S |
| Molecular Weight | 741.39 g/mol |
| Exact Mass | 739.96 |
| IUPAC Name | 2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc4c(c3)OCCO4)C2=O)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H23Cl2IN2O7S/c1-2-38-24-10-16(9-21(32)27(24)41-15-17-3-4-18(30)12-20(17)31)11-25-28(36)34(29(37)42-25)14-26(35)33-19-5-6-22-23(13-19)40-8-7-39-22/h3-6,9-13H,2,7-8,14-15H2,1H3,(H,33,35)/b25-11+ |
| InChIKey | OUZLQTAXRRRSEX-OPEKNORGSA-N |
| XLogP | 7.02 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.39 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|