C27H22N2O2S2 — CID 126212585
(5E)-3-(2,5-dimethylpyrrol-1-yl)-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126212585) has the molecular formula C27H22N2O2S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is (5E)-3-(2,5-dimethylpyrrol-1-yl)-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(2,5-dimethylpyrrol-1-yl)-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126212585 |
| Molecular Formula | C27H22N2O2S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | (5E)-3-(2,5-dimethylpyrrol-1-yl)-5-[(2-phenylmethoxynaphthalen-1-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(C)n1N1C(=O)/C(=C\c2c(OCc3ccccc3)ccc3ccccc23)SC1=S |
| InChI | InChI=1S/C27H22N2O2S2/c1-18-12-13-19(2)28(18)29-26(30)25(33-27(29)32)16-23-22-11-7-6-10-21(22)14-15-24(23)31-17-20-8-4-3-5-9-20/h3-16H,17H2,1-2H3/b25-16+ |
| InChIKey | IVMJBTDVAVUKAG-PCLIKHOPSA-N |
| XLogP | 6.37 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|