C19H17NO4S2 — CID 7341817
ethyl 2-[1-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl]oxyacetate (PubChem CID 7341817) has the molecular formula C19H17NO4S2 and a molecular weight of 387.48 g/mol. Its IUPAC name is ethyl 2-[1-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl]oxyacetate.
| Compound Name | ethyl 2-[1-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl]oxyacetate |
|---|---|
| PubChem CID | 7341817 |
| Molecular Formula | C19H17NO4S2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | ethyl 2-[1-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl]oxyacetate |
| SMILES | CCOC(=O)COc1ccc2ccccc2c1/C=C1/SC(=S)N(C)C1=O |
| InChI | InChI=1S/C19H17NO4S2/c1-3-23-17(21)11-24-15-9-8-12-6-4-5-7-13(12)14(15)10-16-18(22)20(2)19(25)26-16/h4-10H,3,11H2,1-2H3/b16-10+ |
| InChIKey | SRQVKRXFDMKIQP-MHWRWJLKSA-N |
| XLogP | 3.61 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|