C16H9ClN2O5S — CID 126220521
(5E)-3-(3-chlorophenyl)-5-[(2-hydroxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126220521) has the molecular formula C16H9ClN2O5S and a molecular weight of 376.78 g/mol. Its IUPAC name is (5E)-3-(3-chlorophenyl)-5-[(2-hydroxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(3-chlorophenyl)-5-[(2-hydroxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126220521 |
| Molecular Formula | C16H9ClN2O5S |
| Molecular Weight | 376.78 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | (5E)-3-(3-chlorophenyl)-5-[(2-hydroxy-5-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2cc([N+](=O)[O-])ccc2O)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H9ClN2O5S/c17-10-2-1-3-11(8-10)18-15(21)14(25-16(18)22)7-9-6-12(19(23)24)4-5-13(9)20/h1-8,20H/b14-7+ |
| InChIKey | SKWSYMSXWJSPEO-VGOFMYFVSA-N |
| XLogP | 4.19 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.78 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|