C24H17N3O5 — CID 126227169
2-[5-[(E)-[1-(2-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzonitrile (PubChem CID 126227169) has the molecular formula C24H17N3O5 and a molecular weight of 427.42 g/mol. Its IUPAC name is 2-[5-[(E)-[1-(2-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzonitrile.
| Compound Name | 2-[5-[(E)-[1-(2-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 126227169 |
| Molecular Formula | C24H17N3O5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-[5-[(E)-[1-(2-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzonitrile |
| SMILES | CCOc1ccccc1N1C(=O)NC(=O)/C(=C\c2ccc(-c3ccccc3C#N)o2)C1=O |
| InChI | InChI=1S/C24H17N3O5/c1-2-31-21-10-6-5-9-19(21)27-23(29)18(22(28)26-24(27)30)13-16-11-12-20(32-16)17-8-4-3-7-15(17)14-25/h3-13H,2H2,1H3,(H,26,28,30)/b18-13+ |
| InChIKey | IQYPPLJERASFOZ-QGOAFFKASA-N |
| XLogP | 3.88 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|