C23H25BrN2O2 — CID 126227891
(Z)-3-[3-bromo-4-[(2S)-butan-2-yl]oxyphenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126227891) has the molecular formula C23H25BrN2O2 and a molecular weight of 441.37 g/mol. Its IUPAC name is (Z)-3-[3-bromo-4-[(2S)-butan-2-yl]oxyphenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-4-[(2S)-butan-2-yl]oxyphenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126227891 |
| Molecular Formula | C23H25BrN2O2 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | (Z)-3-[3-bromo-4-[(2S)-butan-2-yl]oxyphenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | CC[C@H](C)Oc1ccc(/C=C(/C#N)C(=O)NCCCc2ccccc2)cc1Br |
| InChI | InChI=1S/C23H25BrN2O2/c1-3-17(2)28-22-12-11-19(15-21(22)24)14-20(16-25)23(27)26-13-7-10-18-8-5-4-6-9-18/h4-6,8-9,11-12,14-15,17H,3,7,10,13H2,1-2H3,(H,26,27)/b20-14-/t17-/m0/s1 |
| InChIKey | UWTRKBFRTMKPRH-PNWWAVQQSA-N |
| XLogP | 5.28 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|