C26H19ClN2O3 — CID 126230821
[4-chloro-2-[(E)-(naphthalene-1-carbonylhydrazinylidene)methyl]phenyl] 4-methylbenzoate (PubChem CID 126230821) has the molecular formula C26H19ClN2O3 and a molecular weight of 442.90 g/mol. Its IUPAC name is [4-chloro-2-[(E)-(naphthalene-1-carbonylhydrazinylidene)methyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-chloro-2-[(E)-(naphthalene-1-carbonylhydrazinylidene)methyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126230821 |
| Molecular Formula | C26H19ClN2O3 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | [4-chloro-2-[(E)-(naphthalene-1-carbonylhydrazinylidene)methyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(Cl)cc2/C=N/NC(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C26H19ClN2O3/c1-17-9-11-19(12-10-17)26(31)32-24-14-13-21(27)15-20(24)16-28-29-25(30)23-8-4-6-18-5-2-3-7-22(18)23/h2-16H,1H3,(H,29,30)/b28-16+ |
| InChIKey | LIXIUHUNHWMNCK-LQKURTRISA-N |
| XLogP | 5.78 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|