C17H21ClN2O3 — CID 126235832
(5E)-5-[[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]methylidene]-3-propylimidazolidine-2,4-dione (PubChem CID 126235832) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is (5E)-5-[[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]methylidene]-3-propylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]methylidene]-3-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126235832 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (5E)-5-[[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]methylidene]-3-propylimidazolidine-2,4-dione |
| SMILES | CCCN1C(=O)N/C(=C/c2ccc(O[C@@H](C)CC)c(Cl)c2)C1=O |
| InChI | InChI=1S/C17H21ClN2O3/c1-4-8-20-16(21)14(19-17(20)22)10-12-6-7-15(13(18)9-12)23-11(3)5-2/h6-7,9-11H,4-5,8H2,1-3H3,(H,19,22)/b14-10+/t11-/m0/s1 |
| InChIKey | SDWUSRAXIFZGKJ-IWQAVIMZSA-N |
| XLogP | 3.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|