C23H25N3O3 — CID 126235904
(Z)-2-cyano-N-(4-methoxyphenyl)-3-(2-methoxy-4-piperidin-1-ylphenyl)prop-2-enamide (PubChem CID 126235904) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is (Z)-2-cyano-N-(4-methoxyphenyl)-3-(2-methoxy-4-piperidin-1-ylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(4-methoxyphenyl)-3-(2-methoxy-4-piperidin-1-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126235904 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (Z)-2-cyano-N-(4-methoxyphenyl)-3-(2-methoxy-4-piperidin-1-ylphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C\c2ccc(N3CCCCC3)cc2OC)cc1 |
| InChI | InChI=1S/C23H25N3O3/c1-28-21-10-7-19(8-11-21)25-23(27)18(16-24)14-17-6-9-20(15-22(17)29-2)26-12-4-3-5-13-26/h6-11,14-15H,3-5,12-13H2,1-2H3,(H,25,27)/b18-14- |
| InChIKey | UAKPEMUNDGSVLO-JXAWBTAJSA-N |
| XLogP | 4.24 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|