C24H27N3O2 — CID 126249208
(Z)-2-cyano-N-(3,5-dimethylphenyl)-3-(2-methoxy-4-piperidin-1-ylphenyl)prop-2-enamide (PubChem CID 126249208) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3,5-dimethylphenyl)-3-(2-methoxy-4-piperidin-1-ylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3,5-dimethylphenyl)-3-(2-methoxy-4-piperidin-1-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126249208 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | (Z)-2-cyano-N-(3,5-dimethylphenyl)-3-(2-methoxy-4-piperidin-1-ylphenyl)prop-2-enamide |
| SMILES | COc1cc(N2CCCCC2)ccc1/C=C(/C#N)C(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C24H27N3O2/c1-17-11-18(2)13-21(12-17)26-24(28)20(16-25)14-19-7-8-22(15-23(19)29-3)27-9-5-4-6-10-27/h7-8,11-15H,4-6,9-10H2,1-3H3,(H,26,28)/b20-14- |
| InChIKey | UNTBCIWNIJQQLC-ZHZULCJRSA-N |
| XLogP | 4.85 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|