C22H21N2O3- — CID 7366481
4-[(E)-1-cyano-2-(2-methoxy-4-piperidin-1-ylphenyl)ethenyl]benzoate (PubChem CID 7366481) has the molecular formula C22H21N2O3- and a molecular weight of 361.42 g/mol. Its IUPAC name is 4-[(E)-1-cyano-2-(2-methoxy-4-piperidin-1-ylphenyl)ethenyl]benzoate.
| Compound Name | 4-[(E)-1-cyano-2-(2-methoxy-4-piperidin-1-ylphenyl)ethenyl]benzoate |
|---|---|
| PubChem CID | 7366481 |
| Molecular Formula | C22H21N2O3- |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 4-[(E)-1-cyano-2-(2-methoxy-4-piperidin-1-ylphenyl)ethenyl]benzoate |
| SMILES | COc1cc(N2CCCCC2)ccc1/C=C(/C#N)c1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C22H22N2O3/c1-27-21-14-20(24-11-3-2-4-12-24)10-9-18(21)13-19(15-23)16-5-7-17(8-6-16)22(25)26/h5-10,13-14H,2-4,11-12H2,1H3,(H,25,26)/p-1/b19-13- |
| InChIKey | DRLCCGLEEDXOEX-UYRXBGFRSA-M |
| XLogP | 3.11 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|