C29H20N4O3 — CID 126237087
(5E)-5-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-1-pyridin-3-yl-1,3-diazinane-2,4,6-trione (PubChem CID 126237087) has the molecular formula C29H20N4O3 and a molecular weight of 472.50 g/mol. Its IUPAC name is (5E)-5-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-1-pyridin-3-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-1-pyridin-3-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126237087 |
| Molecular Formula | C29H20N4O3 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (5E)-5-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-1-pyridin-3-yl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2cccnc2)C(=O)/C1=C/c1cn(Cc2ccc3ccccc3c2)c2ccccc12 |
| InChI | InChI=1S/C29H20N4O3/c34-27-25(28(35)33(29(36)31-27)23-8-5-13-30-16-23)15-22-18-32(26-10-4-3-9-24(22)26)17-19-11-12-20-6-1-2-7-21(20)14-19/h1-16,18H,17H2,(H,31,34,36)/b25-15+ |
| InChIKey | HDFCHDOGFUSRRD-MFKUBSTISA-N |
| XLogP | 4.90 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|