C23H22BrClN2O5S2 — CID 126238967
2-[2-bromo-6-methoxy-4-[(Z)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2-chlorophenyl)acetamide (PubChem CID 126238967) has the molecular formula C23H22BrClN2O5S2 and a molecular weight of 585.93 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-[(Z)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[2-bromo-6-methoxy-4-[(Z)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126238967 |
| Molecular Formula | C23H22BrClN2O5S2 |
| Molecular Weight | 585.93 g/mol |
| Exact Mass | 583.98 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-[(Z)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2-chlorophenyl)acetamide |
| SMILES | COCCCN1C(=O)/C(=C/c2cc(Br)c(OCC(=O)Nc3ccccc3Cl)c(OC)c2)SC1=S |
| InChI | InChI=1S/C23H22BrClN2O5S2/c1-30-9-5-8-27-22(29)19(34-23(27)33)12-14-10-15(24)21(18(11-14)31-2)32-13-20(28)26-17-7-4-3-6-16(17)25/h3-4,6-7,10-12H,5,8-9,13H2,1-2H3,(H,26,28)/b19-12- |
| InChIKey | PSMBNHMZCPYNOS-UNOMPAQXSA-N |
| XLogP | 5.37 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.93 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|