C17H16N2O3S — CID 126239214
(5E)-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-3-propylimidazolidine-2,4-dione (PubChem CID 126239214) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is (5E)-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-3-propylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-3-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126239214 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (5E)-5-[(5-phenylsulfanylfuran-2-yl)methylidene]-3-propylimidazolidine-2,4-dione |
| SMILES | CCCN1C(=O)N/C(=C/c2ccc(Sc3ccccc3)o2)C1=O |
| InChI | InChI=1S/C17H16N2O3S/c1-2-10-19-16(20)14(18-17(19)21)11-12-8-9-15(22-12)23-13-6-4-3-5-7-13/h3-9,11H,2,10H2,1H3,(H,18,21)/b14-11+ |
| InChIKey | CXIHNLWHWGLWLH-SDNWHVSQSA-N |
| XLogP | 3.73 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|