C25H20N2O4S2 — CID 126242549
2-[(5Z)-2,4-dioxo-5-[(2-phenylsulfanylphenyl)methylidene]-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 126242549) has the molecular formula C25H20N2O4S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-[(5Z)-2,4-dioxo-5-[(2-phenylsulfanylphenyl)methylidene]-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(5Z)-2,4-dioxo-5-[(2-phenylsulfanylphenyl)methylidene]-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126242549 |
| Molecular Formula | C25H20N2O4S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 2-[(5Z)-2,4-dioxo-5-[(2-phenylsulfanylphenyl)methylidene]-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)S/C(=C\c3ccccc3Sc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H20N2O4S2/c1-31-19-13-11-18(12-14-19)26-23(28)16-27-24(29)22(33-25(27)30)15-17-7-5-6-10-21(17)32-20-8-3-2-4-9-20/h2-15H,16H2,1H3,(H,26,28)/b22-15- |
| InChIKey | FGAGMVBMAQILAC-JCMHNJIXSA-N |
| XLogP | 5.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|