C20H16ClIN2O4S2 — CID 126243657
N-(3-chlorophenyl)-2-[2-iodo-6-methoxy-4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide (PubChem CID 126243657) has the molecular formula C20H16ClIN2O4S2 and a molecular weight of 574.85 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[2-iodo-6-methoxy-4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[2-iodo-6-methoxy-4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126243657 |
| Molecular Formula | C20H16ClIN2O4S2 |
| Molecular Weight | 574.85 g/mol |
| Exact Mass | 573.93 |
| IUPAC Name | N-(3-chlorophenyl)-2-[2-iodo-6-methoxy-4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide |
| SMILES | COc1cc(/C=C2\SC(=S)N(C)C2=O)cc(I)c1OCC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H16ClIN2O4S2/c1-24-19(26)16(30-20(24)29)8-11-6-14(22)18(15(7-11)27-2)28-10-17(25)23-13-5-3-4-12(21)9-13/h3-9H,10H2,1-2H3,(H,23,25)/b16-8- |
| InChIKey | USCHHYXBUJMTLZ-PXNMLYILSA-N |
| XLogP | 4.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.85 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|