C25H28N4O4 — CID 126247998
2-[(4Z)-4-[(2-methoxy-4-piperidin-1-ylphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methylphenyl)acetamide (PubChem CID 126247998) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-[(4Z)-4-[(2-methoxy-4-piperidin-1-ylphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(4Z)-4-[(2-methoxy-4-piperidin-1-ylphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126247998 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2-[(4Z)-4-[(2-methoxy-4-piperidin-1-ylphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methylphenyl)acetamide |
| SMILES | COc1cc(N2CCCCC2)ccc1/C=C1\NC(=O)N(CC(=O)Nc2ccccc2C)C1=O |
| InChI | InChI=1S/C25H28N4O4/c1-17-8-4-5-9-20(17)26-23(30)16-29-24(31)21(27-25(29)32)14-18-10-11-19(15-22(18)33-2)28-12-6-3-7-13-28/h4-5,8-11,14-15H,3,6-7,12-13,16H2,1-2H3,(H,26,30)(H,27,32)/b21-14- |
| InChIKey | YTDBJJOTYDPNPU-STZFKDTASA-N |
| XLogP | 3.53 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|