C30H28N2O6S2 — CID 126248810
2-[4-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-(3,5-dimethylphenyl)acetamide (PubChem CID 126248810) has the molecular formula C30H28N2O6S2 and a molecular weight of 576.70 g/mol. Its IUPAC name is 2-[4-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-(3,5-dimethylphenyl)acetamide.
| Compound Name | 2-[4-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-(3,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126248810 |
| Molecular Formula | C30H28N2O6S2 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | 2-[4-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-(3,5-dimethylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(Cc3ccc4c(c3)OCO4)C2=O)ccc1OCC(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C30H28N2O6S2/c1-4-35-25-12-20(5-7-23(25)36-16-28(33)31-22-10-18(2)9-19(3)11-22)14-27-29(34)32(30(39)40-27)15-21-6-8-24-26(13-21)38-17-37-24/h5-14H,4,15-17H2,1-3H3,(H,31,33)/b27-14- |
| InChIKey | RVGJUFFZCQYJDK-VYYCAZPPSA-N |
| XLogP | 5.85 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|