C28H24N2O5S2 — CID 126262274
2-[3-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 126262274) has the molecular formula C28H24N2O5S2 and a molecular weight of 532.64 g/mol. Its IUPAC name is 2-[3-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[3-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126262274 |
| Molecular Formula | C28H24N2O5S2 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | 2-[3-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2cccc(/C=C3\SC(=S)N(Cc4ccc5c(c4)OCO5)C3=O)c2)c(C)c1 |
| InChI | InChI=1S/C28H24N2O5S2/c1-17-6-8-22(18(2)10-17)29-26(31)15-33-21-5-3-4-19(11-21)13-25-27(32)30(28(36)37-25)14-20-7-9-23-24(12-20)35-16-34-23/h3-13H,14-16H2,1-2H3,(H,29,31)/b25-13- |
| InChIKey | NWNSXCOPMJAMOZ-MXAYSNPKSA-N |
| XLogP | 5.45 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|