C29H28N2O3S2 — CID 126260784
2-[3-[(Z)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 126260784) has the molecular formula C29H28N2O3S2 and a molecular weight of 516.69 g/mol. Its IUPAC name is 2-[3-[(Z)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[3-[(Z)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126260784 |
| Molecular Formula | C29H28N2O3S2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 2-[3-[(Z)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)COc2cccc(/C=C3\SC(=S)N(CCc4ccccc4)C3=O)c2)c(C)c1 |
| InChI | InChI=1S/C29H28N2O3S2/c1-19-14-20(2)27(21(3)15-19)30-26(32)18-34-24-11-7-10-23(16-24)17-25-28(33)31(29(35)36-25)13-12-22-8-5-4-6-9-22/h4-11,14-17H,12-13,18H2,1-3H3,(H,30,32)/b25-17- |
| InChIKey | XVTHWOICPXCGTI-UQQQWYQISA-N |
| XLogP | 6.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|