C24H22FN3O3S — CID 126248908
2-[(5E)-5-[[1-[(2S)-butan-2-yl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 126248908) has the molecular formula C24H22FN3O3S and a molecular weight of 451.52 g/mol. Its IUPAC name is 2-[(5E)-5-[[1-[(2S)-butan-2-yl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[1-[(2S)-butan-2-yl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126248908 |
| Molecular Formula | C24H22FN3O3S |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 2-[(5E)-5-[[1-[(2S)-butan-2-yl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | CC[C@H](C)n1cc(/C=C2/SC(=O)N(CC(=O)Nc3cccc(F)c3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C24H22FN3O3S/c1-3-15(2)27-13-16(19-9-4-5-10-20(19)27)11-21-23(30)28(24(31)32-21)14-22(29)26-18-8-6-7-17(25)12-18/h4-13,15H,3,14H2,1-2H3,(H,26,29)/b21-11+/t15-/m0/s1 |
| InChIKey | XYSNNWDEXXXORV-FPQGOQEYSA-N |
| XLogP | 5.43 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|