C20H17IN2O6 — CID 126248972
(5E)-1-(2-ethoxyphenyl)-5-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126248972) has the molecular formula C20H17IN2O6 and a molecular weight of 508.27 g/mol. Its IUPAC name is (5E)-1-(2-ethoxyphenyl)-5-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(2-ethoxyphenyl)-5-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126248972 |
| Molecular Formula | C20H17IN2O6 |
| Molecular Weight | 508.27 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | (5E)-1-(2-ethoxyphenyl)-5-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1ccccc1N1C(=O)NC(=O)/C(=C\c2cc(I)c(O)c(OC)c2)C1=O |
| InChI | InChI=1S/C20H17IN2O6/c1-3-29-15-7-5-4-6-14(15)23-19(26)12(18(25)22-20(23)27)8-11-9-13(21)17(24)16(10-11)28-2/h4-10,24H,3H2,1-2H3,(H,22,25,27)/b12-8+ |
| InChIKey | OZCXKHBDJJCERS-XYOKQWHBSA-N |
| XLogP | 3.07 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|