C22H20ClIN2O7 — CID 2272006
(5Z)-1-(4-chloro-2,5-dimethoxyphenyl)-5-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 2272006) has the molecular formula C22H20ClIN2O7 and a molecular weight of 586.77 g/mol. Its IUPAC name is (5Z)-1-(4-chloro-2,5-dimethoxyphenyl)-5-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-(4-chloro-2,5-dimethoxyphenyl)-5-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2272006 |
| Molecular Formula | C22H20ClIN2O7 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.00 |
| IUPAC Name | (5Z)-1-(4-chloro-2,5-dimethoxyphenyl)-5-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1cc(/C=C2/C(=O)NC(=O)N(c3cc(OC)c(Cl)cc3OC)C2=O)cc(I)c1OC |
| InChI | InChI=1S/C22H20ClIN2O7/c1-5-33-18-8-11(7-14(24)19(18)32-4)6-12-20(27)25-22(29)26(21(12)28)15-10-16(30-2)13(23)9-17(15)31-3/h6-10H,5H2,1-4H3,(H,25,27,29)/b12-6- |
| InChIKey | BPCIXNCQWCUHJO-SDQBBNPISA-N |
| XLogP | 4.04 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|