C32H26N2O5S2 — CID 126249091
N-(4-ethoxyphenyl)-2-[3-[(Z)-[4-oxo-3-(4-phenoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126249091) has the molecular formula C32H26N2O5S2 and a molecular weight of 582.70 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[3-[(Z)-[4-oxo-3-(4-phenoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[3-[(Z)-[4-oxo-3-(4-phenoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126249091 |
| Molecular Formula | C32H26N2O5S2 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[3-[(Z)-[4-oxo-3-(4-phenoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | CCOc1ccc(NC(=O)COc2cccc(/C=C3\SC(=S)N(c4ccc(Oc5ccccc5)cc4)C3=O)c2)cc1 |
| InChI | InChI=1S/C32H26N2O5S2/c1-2-37-25-15-11-23(12-16-25)33-30(35)21-38-28-10-6-7-22(19-28)20-29-31(36)34(32(40)41-29)24-13-17-27(18-14-24)39-26-8-4-3-5-9-26/h3-20H,2,21H2,1H3,(H,33,35)/b29-20- |
| InChIKey | WRQYHYWEBGGNHC-BRPDVVIDSA-N |
| XLogP | 7.30 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|