C21H17ClN2O4 — CID 126250873
(5E)-3-benzyl-5-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 126250873) has the molecular formula C21H17ClN2O4 and a molecular weight of 396.83 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-benzyl-5-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126250873 |
| Molecular Formula | C21H17ClN2O4 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | (5E)-3-benzyl-5-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | C#CCOc1c(Cl)cc(/C=C2/NC(=O)N(Cc3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C21H17ClN2O4/c1-3-9-28-19-16(22)10-15(12-18(19)27-2)11-17-20(25)24(21(26)23-17)13-14-7-5-4-6-8-14/h1,4-8,10-12H,9,13H2,2H3,(H,23,26)/b17-11+ |
| InChIKey | HICSTZGSAXESFV-GZTJUZNOSA-N |
| XLogP | 3.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|