C20H15Br2ClN2O5 — CID 126251220
(5E)-1-(3-chloro-2-methylphenyl)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126251220) has the molecular formula C20H15Br2ClN2O5 and a molecular weight of 558.61 g/mol. Its IUPAC name is (5E)-1-(3-chloro-2-methylphenyl)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(3-chloro-2-methylphenyl)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126251220 |
| Molecular Formula | C20H15Br2ClN2O5 |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 555.90 |
| IUPAC Name | (5E)-1-(3-chloro-2-methylphenyl)-5-[(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3cccc(Cl)c3C)C2=O)c(Br)c(Br)c1O |
| InChI | InChI=1S/C20H15Br2ClN2O5/c1-3-30-14-8-10(15(21)16(22)17(14)26)7-11-18(27)24-20(29)25(19(11)28)13-6-4-5-12(23)9(13)2/h4-8,26H,3H2,1-2H3,(H,24,27,29)/b11-7+ |
| InChIKey | MLQYNYPWAFBNHX-YRNVUSSQSA-N |
| XLogP | 4.94 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|