C19H22FNO2 — CID 12625681
3-[[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]amino]-1-(4-methylphenyl)propan-1-one (PubChem CID 12625681) has the molecular formula C19H22FNO2 and a molecular weight of 315.39 g/mol. Its IUPAC name is 3-[[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]amino]-1-(4-methylphenyl)propan-1-one.
| Compound Name | 3-[[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]amino]-1-(4-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 12625681 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-[[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]amino]-1-(4-methylphenyl)propan-1-one |
| SMILES | Cc1ccc(C(=O)CCNC(C)C(O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H22FNO2/c1-13-3-5-15(6-4-13)18(22)11-12-21-14(2)19(23)16-7-9-17(20)10-8-16/h3-10,14,19,21,23H,11-12H2,1-2H3 |
| InChIKey | HZDLSWXFYLMXQX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |