C18H18FNO3 — CID 111115069
N-[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-2-(4-methylphenyl)-2-oxoacetamide (PubChem CID 111115069) has the molecular formula C18H18FNO3 and a molecular weight of 315.34 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-2-(4-methylphenyl)-2-oxoacetamide.
| Compound Name | N-[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-2-(4-methylphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 111115069 |
| Molecular Formula | C18H18FNO3 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-2-(4-methylphenyl)-2-oxoacetamide |
| SMILES | Cc1ccc(C(=O)C(=O)NC(C)C(O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H18FNO3/c1-11-3-5-14(6-4-11)17(22)18(23)20-12(2)16(21)13-7-9-15(19)10-8-13/h3-10,12,16,21H,1-2H3,(H,20,23) |
| InChIKey | UEPGPKSZPRZFOJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|