C24H21F3N2O4S2 — CID 126257055
2-[2-ethoxy-4-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 126257055) has the molecular formula C24H21F3N2O4S2 and a molecular weight of 522.57 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-ethoxy-4-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 126257055 |
| Molecular Formula | C24H21F3N2O4S2 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | 2-[2-ethoxy-4-[(Z)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | C=CCN1C(=O)/C(=C/c2ccc(OCC(=O)Nc3cccc(C(F)(F)F)c3)c(OCC)c2)SC1=S |
| InChI | InChI=1S/C24H21F3N2O4S2/c1-3-10-29-22(31)20(35-23(29)34)12-15-8-9-18(19(11-15)32-4-2)33-14-21(30)28-17-7-5-6-16(13-17)24(25,26)27/h3,5-9,11-13H,1,4,10,14H2,2H3,(H,28,30)/b20-12- |
| InChIKey | NEBLGCPBQYUXHS-NDENLUEZSA-N |
| XLogP | 5.51 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|