C24H20ClFN4O4 — CID 126262087
N'-[(Z)-[2-[2-(benzylamino)-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-(2-fluorophenyl)oxamide (PubChem CID 126262087) has the molecular formula C24H20ClFN4O4 and a molecular weight of 482.90 g/mol. Its IUPAC name is N'-[(Z)-[2-[2-(benzylamino)-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-(2-fluorophenyl)oxamide.
| Compound Name | N'-[(Z)-[2-[2-(benzylamino)-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-(2-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 126262087 |
| Molecular Formula | C24H20ClFN4O4 |
| Molecular Weight | 482.90 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | N'-[(Z)-[2-[2-(benzylamino)-2-oxoethoxy]-5-chlorophenyl]methylideneamino]-N-(2-fluorophenyl)oxamide |
| SMILES | O=C(COc1ccc(Cl)cc1/C=N\NC(=O)C(=O)Nc1ccccc1F)NCc1ccccc1 |
| InChI | InChI=1S/C24H20ClFN4O4/c25-18-10-11-21(34-15-22(31)27-13-16-6-2-1-3-7-16)17(12-18)14-28-30-24(33)23(32)29-20-9-5-4-8-19(20)26/h1-12,14H,13,15H2,(H,27,31)(H,29,32)(H,30,33)/b28-14- |
| InChIKey | LWNWMAAHSBXHFP-MUXKCCDJSA-N |
| XLogP | 3.26 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.90 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|