C18H16ClN3O5 — CID 8989647
2-[2-[(Z)-[[2-(benzylamino)-2-oxoacetyl]hydrazinylidene]methyl]-4-chlorophenoxy]acetic acid (PubChem CID 8989647) has the molecular formula C18H16ClN3O5 and a molecular weight of 389.80 g/mol. Its IUPAC name is 2-[2-[(Z)-[[2-(benzylamino)-2-oxoacetyl]hydrazinylidene]methyl]-4-chlorophenoxy]acetic acid.
| Compound Name | 2-[2-[(Z)-[[2-(benzylamino)-2-oxoacetyl]hydrazinylidene]methyl]-4-chlorophenoxy]acetic acid |
|---|---|
| PubChem CID | 8989647 |
| Molecular Formula | C18H16ClN3O5 |
| Molecular Weight | 389.80 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 2-[2-[(Z)-[[2-(benzylamino)-2-oxoacetyl]hydrazinylidene]methyl]-4-chlorophenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(Cl)cc1/C=N\NC(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H16ClN3O5/c19-14-6-7-15(27-11-16(23)24)13(8-14)10-21-22-18(26)17(25)20-9-12-4-2-1-3-5-12/h1-8,10H,9,11H2,(H,20,25)(H,22,26)(H,23,24)/b21-10- |
| InChIKey | NJKOHMPKAGJQNG-FBHDLOMBSA-N |
| XLogP | 1.57 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.80 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|