C23H18BrN3O4S — CID 126263507
2-[5-bromo-2-[(2-nitrophenyl)methoxy]phenyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 126263507) has the molecular formula C23H18BrN3O4S and a molecular weight of 512.39 g/mol. Its IUPAC name is 2-[5-bromo-2-[(2-nitrophenyl)methoxy]phenyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[5-bromo-2-[(2-nitrophenyl)methoxy]phenyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 126263507 |
| Molecular Formula | C23H18BrN3O4S |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 511.02 |
| IUPAC Name | 2-[5-bromo-2-[(2-nitrophenyl)methoxy]phenyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2cc(Br)ccc2OCc2ccccc2[N+](=O)[O-])nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C23H18BrN3O4S/c24-14-9-10-18(31-12-13-5-1-3-7-17(13)27(29)30)16(11-14)21-25-22(28)20-15-6-2-4-8-19(15)32-23(20)26-21/h1,3,5,7,9-11H,2,4,6,8,12H2,(H,25,26,28) |
| InChIKey | QCTGKOBRMMOLKW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|