C29H32FN3O3S — CID 126264894
2-[2-ethoxy-4-[4-(2-fluorophenyl)piperazine-1-carbothioyl]phenoxy]-N-(2-ethylphenyl)acetamide (PubChem CID 126264894) has the molecular formula C29H32FN3O3S and a molecular weight of 521.66 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[4-(2-fluorophenyl)piperazine-1-carbothioyl]phenoxy]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[4-(2-fluorophenyl)piperazine-1-carbothioyl]phenoxy]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126264894 |
| Molecular Formula | C29H32FN3O3S |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 2-[2-ethoxy-4-[4-(2-fluorophenyl)piperazine-1-carbothioyl]phenoxy]-N-(2-ethylphenyl)acetamide |
| SMILES | CCOc1cc(C(=S)N2CCN(c3ccccc3F)CC2)ccc1OCC(=O)Nc1ccccc1CC |
| InChI | InChI=1S/C29H32FN3O3S/c1-3-21-9-5-7-11-24(21)31-28(34)20-36-26-14-13-22(19-27(26)35-4-2)29(37)33-17-15-32(16-18-33)25-12-8-6-10-23(25)30/h5-14,19H,3-4,15-18,20H2,1-2H3,(H,31,34) |
| InChIKey | ZPLUVUPYNKCXTP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|