C19H21FN2O2S — CID 3706873
(3,4-dimethoxyphenyl)-[4-(2-fluorophenyl)piperazin-1-yl]methanethione (PubChem CID 3706873) has the molecular formula C19H21FN2O2S and a molecular weight of 360.45 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-[4-(2-fluorophenyl)piperazin-1-yl]methanethione.
| Compound Name | (3,4-dimethoxyphenyl)-[4-(2-fluorophenyl)piperazin-1-yl]methanethione |
|---|---|
| PubChem CID | 3706873 |
| Molecular Formula | C19H21FN2O2S |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (3,4-dimethoxyphenyl)-[4-(2-fluorophenyl)piperazin-1-yl]methanethione |
| SMILES | COc1ccc(C(=S)N2CCN(c3ccccc3F)CC2)cc1OC |
| InChI | InChI=1S/C19H21FN2O2S/c1-23-17-8-7-14(13-18(17)24-2)19(25)22-11-9-21(10-12-22)16-6-4-3-5-15(16)20/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | VMWOMBOBBWADRA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|