C25H15F3I2N2O4S — CID 126268881
2-[(5E)-5-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 126268881) has the molecular formula C25H15F3I2N2O4S and a molecular weight of 750.27 g/mol. Its IUPAC name is 2-[(5E)-5-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 126268881 |
| Molecular Formula | C25H15F3I2N2O4S |
| Molecular Weight | 750.27 g/mol |
| Exact Mass | 749.88 |
| IUPAC Name | 2-[(5E)-5-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cc(I)c(OCc3ccccc3)c(I)c2)C1=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C25H15F3I2N2O4S/c26-15-6-7-18(22(28)21(15)27)31-20(33)11-32-24(34)19(37-25(32)35)10-14-8-16(29)23(17(30)9-14)36-12-13-4-2-1-3-5-13/h1-10H,11-12H2,(H,31,33)/b19-10+ |
| InChIKey | GNNCHXGFHAUANQ-VXLYETTFSA-N |
| XLogP | 6.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.27 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|