C29H24Cl3N3O6 — CID 126269923
2-[2-chloro-4-[(Z)-[1-(3-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-ethoxyphenoxy]-N-(3-chloro-4-methylphenyl)acetamide (PubChem CID 126269923) has the molecular formula C29H24Cl3N3O6 and a molecular weight of 616.89 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-[1-(3-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-ethoxyphenoxy]-N-(3-chloro-4-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(Z)-[1-(3-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-ethoxyphenoxy]-N-(3-chloro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126269923 |
| Molecular Formula | C29H24Cl3N3O6 |
| Molecular Weight | 616.89 g/mol |
| Exact Mass | 615.07 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-[1-(3-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-ethoxyphenoxy]-N-(3-chloro-4-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/C(=O)NC(=O)N(c3cccc(Cl)c3C)C2=O)cc(Cl)c1OCC(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C29H24Cl3N3O6/c1-4-40-24-12-17(11-22(32)26(24)41-14-25(36)33-18-9-8-15(2)21(31)13-18)10-19-27(37)34-29(39)35(28(19)38)23-7-5-6-20(30)16(23)3/h5-13H,4,14H2,1-3H3,(H,33,36)(H,34,37,39)/b19-10- |
| InChIKey | BWXHAMMPIGDIAB-GRSHGNNSSA-N |
| XLogP | 6.35 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.89 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|