C27H19Br2Cl2N3O5 — CID 126275357
N-(3-chloro-4-methylphenyl)-2-[2,6-dibromo-4-[(Z)-[1-(3-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126275357) has the molecular formula C27H19Br2Cl2N3O5 and a molecular weight of 696.18 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[2,6-dibromo-4-[(Z)-[1-(3-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[2,6-dibromo-4-[(Z)-[1-(3-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126275357 |
| Molecular Formula | C27H19Br2Cl2N3O5 |
| Molecular Weight | 696.18 g/mol |
| Exact Mass | 692.91 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[2,6-dibromo-4-[(Z)-[1-(3-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Br)cc(/C=C3/C(=O)NC(=O)N(c4cccc(Cl)c4C)C3=O)cc2Br)cc1Cl |
| InChI | InChI=1S/C27H19Br2Cl2N3O5/c1-13-6-7-16(11-21(13)31)32-23(35)12-39-24-18(28)9-15(10-19(24)29)8-17-25(36)33-27(38)34(26(17)37)22-5-3-4-20(30)14(22)2/h3-11H,12H2,1-2H3,(H,32,35)(H,33,36,38)/b17-8- |
| InChIKey | GUAAGUZHTRZMJJ-IUXPMGMMSA-N |
| XLogP | 6.82 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.18 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|