C25H19I2N3O5S — CID 126272208
2-[(5Z)-5-[[3-iodo-5-methoxy-4-(pyridin-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide (PubChem CID 126272208) has the molecular formula C25H19I2N3O5S and a molecular weight of 727.32 g/mol. Its IUPAC name is 2-[(5Z)-5-[[3-iodo-5-methoxy-4-(pyridin-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[[3-iodo-5-methoxy-4-(pyridin-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 126272208 |
| Molecular Formula | C25H19I2N3O5S |
| Molecular Weight | 727.32 g/mol |
| Exact Mass | 726.91 |
| IUPAC Name | 2-[(5Z)-5-[[3-iodo-5-methoxy-4-(pyridin-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(I)cc3)C2=O)cc(I)c1OCc1ccccn1 |
| InChI | InChI=1S/C25H19I2N3O5S/c1-34-20-11-15(10-19(27)23(20)35-14-18-4-2-3-9-28-18)12-21-24(32)30(25(33)36-21)13-22(31)29-17-7-5-16(26)6-8-17/h2-12H,13-14H2,1H3,(H,29,31)/b21-12- |
| InChIKey | VVMMPTMTOLSWLC-MTJSOVHGSA-N |
| XLogP | 5.55 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.32 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|